About tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate
tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate (PubChem CID 158405811) has the molecular formula C23H33BrO4
and a molecular weight of 453.42 g/mol. Its IUPAC name is tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate.
Molecular Properties
| Compound Name | tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate |
| PubChem CID | 158405811 |
| Molecular Formula | C23H33BrO4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate |
| SMILES | CC(C)CC(CCC(=O)Cc1ccc(Br)cc1)C(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33BrO4/c1-16(2)14-18(21(26)12-13-22(27)28-23(3,4)5)8-11-20(25)15-17-6-9-19(24)10-7-17/h6-7,9-10,16,18H,8,11-15H2,1-5H3 |
| InChIKey | GYRGWUGUWVIYCQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate?
The IUPAC name of tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate (CID 158405811) is tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate.
What is the SMILES notation for tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate?
The canonical SMILES for tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate is CC(C)CC(CCC(=O)Cc1ccc(Br)cc1)C(=O)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate?
The InChIKey is GYRGWUGUWVIYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33BrO4/c1-16(2)14-18(21(26)12-13-22(27)28-23(3,4)5)8-11-20(25)15-17-6-9-19(24)10-7-17/h6-7,9-10,16,18H,8,11-15H2,1-5H3.
What are the key properties of tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate?
tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate has a molecular weight of 453.42 g/mol, XLogP of 5.69, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate is sourced from PubChem (CID 158405811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).