C23H33BrO4 — CID 158405811
tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate (PubChem CID 158405811) has the molecular formula C23H33BrO4 and a molecular weight of 453.42 g/mol. Its IUPAC name is tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate.
| Compound Name | tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate |
|---|---|
| PubChem CID | 158405811 |
| Molecular Formula | C23H33BrO4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | tert-butyl 9-(4-bromophenyl)-5-(2-methylpropyl)-4,8-dioxononanoate |
| SMILES | CC(C)CC(CCC(=O)Cc1ccc(Br)cc1)C(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33BrO4/c1-16(2)14-18(21(26)12-13-22(27)28-23(3,4)5)8-11-20(25)15-17-6-9-19(24)10-7-17/h6-7,9-10,16,18H,8,11-15H2,1-5H3 |
| InChIKey | GYRGWUGUWVIYCQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |