C27H46O12 — CID 158405936
(2S,4S,5S)-6-[(2R)-butan-2-yl]-2-(hydroxymethyl)-4,5-dimethyl-3-phenylmethoxyoxan-2-ol;(2S,4S,5S)-6-[(1R)-1,2-dihydroxyethyl]-2-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 158405936) has the molecular formula C27H46O12 and a molecular weight of 562.65 g/mol. Its IUPAC name is (2S,4S,5S)-6-[(2R)-butan-2-yl]-2-(hydroxymethyl)-4,5-dimethyl-3-phenylmethoxyoxan-2-ol;(2S,4S,5S)-6-[(1R)-1,2-dihydroxyethyl]-2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,4S,5S)-6-[(2R)-butan-2-yl]-2-(hydroxymethyl)-4,5-dimethyl-3-phenylmethoxyoxan-2-ol;(2S,4S,5S)-6-[(1R)-1,2-dihydroxyethyl]-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 158405936 |
| Molecular Formula | C27H46O12 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | (2S,4S,5S)-6-[(2R)-butan-2-yl]-2-(hydroxymethyl)-4,5-dimethyl-3-phenylmethoxyoxan-2-ol;(2S,4S,5S)-6-[(1R)-1,2-dihydroxyethyl]-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CC[C@@H](C)C1O[C@@](O)(CO)C(OCc2ccccc2)[C@@H](C)[C@@H]1C.OC[C@@H](O)C1O[C@@](O)(CO)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H30O4.C8H16O8/c1-5-13(2)17-14(3)15(4)18(19(21,12-20)23-17)22-11-16-9-7-6-8-10-16;9-1-3(11)6-4(12)5(13)7(14)8(15,2-10)16-6/h6-10,13-15,17-18,20-21H,5,11-12H2,1-4H3;3-7,9-15H,1-2H2/t13-,14+,15+,17?,18?,19+;3-,4+,5+,6?,7?,8+/m11/s1 |
| InChIKey | GYRSERDAZQPWFR-LUOZGLNASA-N |
| XLogP | -1.53 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |