C29H28N10O2 — CID 158406190
N-hydroxy-2-[2-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethyl-methylamino]pyrimidine-5-carboxamide (PubChem CID 158406190) has the molecular formula C29H28N10O2 and a molecular weight of 548.61 g/mol. Its IUPAC name is N-hydroxy-2-[2-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethyl-methylamino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethyl-methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 158406190 |
| Molecular Formula | C29H28N10O2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | N-hydroxy-2-[2-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethyl-methylamino]pyrimidine-5-carboxamide |
| SMILES | CN(CCN(C)c1ncc(C(=O)NO)cn1)c1ccc(Nc2nc(-c3ccc4c(c3)CN=C4)cn3ccnc23)cc1 |
| InChI | InChI=1S/C29H28N10O2/c1-37(11-12-38(2)29-32-16-22(17-33-29)28(40)36-41)24-7-5-23(6-8-24)34-26-27-31-9-10-39(27)18-25(35-26)19-3-4-20-14-30-15-21(20)13-19/h3-10,13-14,16-18,41H,11-12,15H2,1-2H3,(H,34,35)(H,36,40) |
| InChIKey | GYMZHFWIGIOTDO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 136.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|