C9H20N2O2 — CID 158406361
N-[(3-hydroxy-1-methylazetidin-3-yl)methyl]propanamide;methane (PubChem CID 158406361) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(3-hydroxy-1-methylazetidin-3-yl)methyl]propanamide;methane.
| Compound Name | N-[(3-hydroxy-1-methylazetidin-3-yl)methyl]propanamide;methane |
|---|---|
| PubChem CID | 158406361 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N-[(3-hydroxy-1-methylazetidin-3-yl)methyl]propanamide;methane |
| SMILES | C.CCC(=O)NCC1(O)CN(C)C1 |
| InChI | InChI=1S/C8H16N2O2.CH4/c1-3-7(11)9-4-8(12)5-10(2)6-8;/h12H,3-6H2,1-2H3,(H,9,11);1H4 |
| InChIKey | GYTAZVZMOSDHRF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |