C23H29Cl2N4O8P — CID 158406978
[4-[[4-[2-(2,6-dichlorophenyl)-2-oxoethyl]-1H-pyrazole-5-carbonyl]amino]piperidin-1-yl]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 158406978) has the molecular formula C23H29Cl2N4O8P and a molecular weight of 591.39 g/mol. Its IUPAC name is [4-[[4-[2-(2,6-dichlorophenyl)-2-oxoethyl]-1H-pyrazole-5-carbonyl]amino]piperidin-1-yl]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [4-[[4-[2-(2,6-dichlorophenyl)-2-oxoethyl]-1H-pyrazole-5-carbonyl]amino]piperidin-1-yl]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 158406978 |
| Molecular Formula | C23H29Cl2N4O8P |
| Molecular Weight | 591.39 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | [4-[[4-[2-(2,6-dichlorophenyl)-2-oxoethyl]-1H-pyrazole-5-carbonyl]amino]piperidin-1-yl]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)CN1CCC(NC(=O)c2[nH]ncc2CC(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C23H29Cl2N4O8P/c1-14(2)37-23(32)35-13-36-38(33,34)12-29-8-6-16(7-9-29)27-22(31)21-15(11-26-28-21)10-19(30)20-17(24)4-3-5-18(20)25/h3-5,11,14,16H,6-10,12-13H2,1-2H3,(H,26,28)(H,27,31)(H,33,34) |
| InChIKey | GYVAOAOBPVJKFH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 160.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|