C27H20F6N2 — CID 158407321
2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole (PubChem CID 158407321) has the molecular formula C27H20F6N2 and a molecular weight of 486.46 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole |
|---|---|
| PubChem CID | 158407321 |
| Molecular Formula | C27H20F6N2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole |
| SMILES | CC1=Nc2cc3c(cc2C1)CC(c1ccc(C(c2ccc(C)cc2)(C(F)(F)F)C(F)(F)F)cc1)=N3 |
| InChI | InChI=1S/C27H20F6N2/c1-15-3-7-20(8-4-15)25(26(28,29)30,27(31,32)33)21-9-5-17(6-10-21)22-13-19-12-18-11-16(2)34-23(18)14-24(19)35-22/h3-10,12,14H,11,13H2,1-2H3 |
| InChIKey | QSFCYENTBKPNMJ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |