C10H13NO — CID 15840809
7-amino-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 15840809) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 7-amino-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 7-amino-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 15840809 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 7-amino-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | Nc1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C10H13NO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6,10,12H,1-3,11H2 |
| InChIKey | NUDRGEJVHRQBJZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|