C26H32N2O2 — CID 15840824
(2S,8R,10S)-10-[(3,4-dimethoxyphenyl)methyl]-16-methyl-9,12-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),13(18),14,16-tetraene (PubChem CID 15840824) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2S,8R,10S)-10-[(3,4-dimethoxyphenyl)methyl]-16-methyl-9,12-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),13(18),14,16-tetraene.
| Compound Name | (2S,8R,10S)-10-[(3,4-dimethoxyphenyl)methyl]-16-methyl-9,12-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),13(18),14,16-tetraene |
|---|---|
| PubChem CID | 15840824 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (2S,8R,10S)-10-[(3,4-dimethoxyphenyl)methyl]-16-methyl-9,12-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),13(18),14,16-tetraene |
| SMILES | COc1ccc(C[C@@H]2N[C@@H]3CCCCC[C@H]3c3c2[nH]c2ccc(C)cc32)cc1OC |
| InChI | InChI=1S/C26H32N2O2/c1-16-9-11-21-19(13-16)25-18-7-5-4-6-8-20(18)27-22(26(25)28-21)14-17-10-12-23(29-2)24(15-17)30-3/h9-13,15,18,20,22,27-28H,4-8,14H2,1-3H3/t18-,20-,22+/m1/s1 |
| InChIKey | GNKCUDPPWLHUCI-UZKOGDIHSA-N |
| XLogP | 5.80 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|