C60H63N9O12 — CID 158408774
5,5-dimethyl-3-[6-[(4-methyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 158408774) has the molecular formula C60H63N9O12 and a molecular weight of 1102.21 g/mol. Its IUPAC name is 5,5-dimethyl-3-[6-[(4-methyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[6-[(4-methyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 158408774 |
| Molecular Formula | C60H63N9O12 |
| Molecular Weight | 1102.21 g/mol |
| Exact Mass | 1101.46 |
| IUPAC Name | 5,5-dimethyl-3-[6-[(4-methyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | CC1CCOc2cccc(Oc3ccc(N4C(=O)NC(C)(C)C4=O)cn3)c21.CC1CCOc2cccc(Oc3ccc(N4C(=O)NC(C)(C)C4=O)cn3)c21.CC1CCOc2cccc(Oc3ccc(N4C(=O)NC(C)(C)C4=O)cn3)c21 |
| InChI | InChI=1S/3C20H21N3O4/c3*1-12-9-10-26-14-5-4-6-15(17(12)14)27-16-8-7-13(11-21-16)23-18(24)20(2,3)22-19(23)25/h3*4-8,11-12H,9-10H2,1-3H3,(H,22,25) |
| InChIKey | GZAOFCJLGAJKRP-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 242.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1102.21 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|