C37H43N3O6 — CID 158409232
(4R,5S)-5-[4-[4-[4-[2-[(4S,5R)-5-(4-methylpentanoyl)-1,3-dioxolan-4-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-N-(2-methylpropyl)-1,3-dioxolane-4-carboxamide (PubChem CID 158409232) has the molecular formula C37H43N3O6 and a molecular weight of 625.77 g/mol. Its IUPAC name is (4R,5S)-5-[4-[4-[4-[2-[(4S,5R)-5-(4-methylpentanoyl)-1,3-dioxolan-4-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-N-(2-methylpropyl)-1,3-dioxolane-4-carboxamide.
| Compound Name | (4R,5S)-5-[4-[4-[4-[2-[(4S,5R)-5-(4-methylpentanoyl)-1,3-dioxolan-4-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-N-(2-methylpropyl)-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 158409232 |
| Molecular Formula | C37H43N3O6 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | (4R,5S)-5-[4-[4-[4-[2-[(4S,5R)-5-(4-methylpentanoyl)-1,3-dioxolan-4-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-N-(2-methylpropyl)-1,3-dioxolane-4-carboxamide |
| SMILES | CC(C)CCC(=O)[C@@H]1OCO[C@H]1C1=NC=C(c2ccc(-c3ccc(C4=CN=C([C@@H]5OCO[C@H]5C(=O)NCC(C)C)C4)cc3)cc2)C1 |
| InChI | InChI=1S/C37H43N3O6/c1-22(2)5-14-32(41)35-33(43-20-45-35)30-15-28(18-38-30)26-10-6-24(7-11-26)25-8-12-27(13-9-25)29-16-31(39-19-29)34-36(46-21-44-34)37(42)40-17-23(3)4/h6-13,18-19,22-23,33-36H,5,14-17,20-21H2,1-4H3,(H,40,42)/t33-,34-,35-,36+/m0/s1 |
| InChIKey | ODQIKGSJJKGWOL-SKXFTCKDSA-N |
| XLogP | 5.99 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |