C20H22F3NO9 — CID 158409397
methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate (PubChem CID 158409397) has the molecular formula C20H22F3NO9 and a molecular weight of 477.39 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 158409397 |
| Molecular Formula | C20H22F3NO9 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(F)(F)F)cc2NC=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C20H22F3NO9/c1-9-15(30-10(2)26)17(31-11(3)27)19(33-16(9)18(28)29-4)32-14-6-5-12(20(21,22)23)7-13(14)24-8-25/h5-9,15-17,19H,1-4H3,(H,24,25)/t9-,15-,16-,17+,19+/m0/s1 |
| InChIKey | GZCMNXXYSOPGPE-HNYQSSBKSA-N |
| XLogP | 2.05 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|