About benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol
benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol (PubChem CID 158410244) has the molecular formula C12H18S6
and a molecular weight of 354.68 g/mol. Its IUPAC name is benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol.
Molecular Properties
| Compound Name | benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol |
| PubChem CID | 158410244 |
| Molecular Formula | C12H18S6 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol |
| SMILES | SCC1CSC(CS)CS1.Sc1cccc(S)c1 |
| InChI | InChI=1S/C6H12S4.C6H6S2/c7-1-5-3-10-6(2-8)4-9-5;7-5-2-1-3-6(8)4-5/h5-8H,1-4H2;1-4,7-8H |
| InChIKey | GZFHOXNWUIUPTA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The IUPAC name of benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol (CID 158410244) is benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol.
What is the SMILES notation for benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The canonical SMILES for benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol is SCC1CSC(CS)CS1.Sc1cccc(S)c1.
What is the InChIKey of benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The InChIKey is GZFHOXNWUIUPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S4.C6H6S2/c7-1-5-3-10-6(2-8)4-9-5;7-5-2-1-3-6(8)4-5/h5-8H,1-4H2;1-4,7-8H.
What are the key properties of benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol has a molecular weight of 354.68 g/mol, XLogP of 4.33, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dithiol;[5-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol is sourced from PubChem (CID 158410244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).