C6HF5O3STa — CID 158411832
2,3,4,5,6-pentafluorobenzenesulfonic acid;tantalum (PubChem CID 158411832) has the molecular formula C6HF5O3STa and a molecular weight of 429.08 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenesulfonic acid;tantalum.
| Compound Name | 2,3,4,5,6-pentafluorobenzenesulfonic acid;tantalum |
|---|---|
| PubChem CID | 158411832 |
| Molecular Formula | C6HF5O3STa |
| Molecular Weight | 429.08 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfonic acid;tantalum |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F.[Ta] |
| InChI | InChI=1S/C6HF5O3S.Ta/c7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9;/h(H,12,13,14); |
| InChIKey | GZKINRSRAXNYAT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|