C32H34O6 — CID 158411977
2-benzoyl-4,4,6-trimethylcyclohexane-1,3-dione;2-benzoyl-4,6,6-trimethylcyclohex-4-ene-1,3-dione (PubChem CID 158411977) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-benzoyl-4,4,6-trimethylcyclohexane-1,3-dione;2-benzoyl-4,6,6-trimethylcyclohex-4-ene-1,3-dione.
| Compound Name | 2-benzoyl-4,4,6-trimethylcyclohexane-1,3-dione;2-benzoyl-4,6,6-trimethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 158411977 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-benzoyl-4,4,6-trimethylcyclohexane-1,3-dione;2-benzoyl-4,6,6-trimethylcyclohex-4-ene-1,3-dione |
| SMILES | CC1=CC(C)(C)C(=O)C(C(=O)c2ccccc2)C1=O.CC1CC(C)(C)C(=O)C(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H18O3.C16H16O3/c2*1-10-9-16(2,3)15(19)12(13(10)17)14(18)11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3;4-9,12H,1-3H3 |
| InChIKey | GZKPYPBXGYCOIZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|