About 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane
2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane (PubChem CID 158415055) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane.
Molecular Properties
| Compound Name | 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane |
| PubChem CID | 158415055 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane |
| SMILES | C.Cc1ccc(CNc2cc(=O)n(C)c(N)n2)cc1C |
| InChI | InChI=1S/C14H18N4O.CH4/c1-9-4-5-11(6-10(9)2)8-16-12-7-13(19)18(3)14(15)17-12;/h4-7,16H,8H2,1-3H3,(H2,15,17);1H4 |
| InChIKey | GZUBSWMJVXZELL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane?
The IUPAC name of 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane (CID 158415055) is 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane.
What is the SMILES notation for 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane?
The canonical SMILES for 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane is C.Cc1ccc(CNc2cc(=O)n(C)c(N)n2)cc1C.
What is the InChIKey of 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane?
The InChIKey is GZUBSWMJVXZELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O.CH4/c1-9-4-5-11(6-10(9)2)8-16-12-7-13(19)18(3)14(15)17-12;/h4-7,16H,8H2,1-3H3,(H2,15,17);1H4.
What are the key properties of 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane?
2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane has a molecular weight of 274.37 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[(3,4-dimethylphenyl)methylamino]-3-methylpyrimidin-4-one;methane is sourced from PubChem (CID 158415055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).