About 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one
1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one (PubChem CID 158415573) has the molecular formula C12H16FNO5
and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one.
Molecular Properties
| Compound Name | 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one |
| PubChem CID | 158415573 |
| Molecular Formula | C12H16FNO5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one |
| SMILES | CC(CO)C(=O)CNCc1cc(F)c(O)c(O)c1O |
| InChI | InChI=1S/C12H16FNO5/c1-6(5-15)9(16)4-14-3-7-2-8(13)11(18)12(19)10(7)17/h2,6,14-15,17-19H,3-5H2,1H3 |
| InChIKey | LBOFPBYQBDOEOL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one?
The IUPAC name of 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one (CID 158415573) is 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one.
What is the SMILES notation for 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one?
The canonical SMILES for 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one is CC(CO)C(=O)CNCc1cc(F)c(O)c(O)c1O.
What is the InChIKey of 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one?
The InChIKey is LBOFPBYQBDOEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO5/c1-6(5-15)9(16)4-14-3-7-2-8(13)11(18)12(19)10(7)17/h2,6,14-15,17-19H,3-5H2,1H3.
What are the key properties of 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one?
1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one has a molecular weight of 273.26 g/mol, XLogP of 0.23, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-fluoro-2,3,4-trihydroxyphenyl)methylamino]-4-hydroxy-3-methylbutan-2-one is sourced from PubChem (CID 158415573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).