C18H20N2O4Ru — CID 158415577
2-(4-hexoxycarbonyl-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium (PubChem CID 158415577) has the molecular formula C18H20N2O4Ru and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-(4-hexoxycarbonyl-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium.
| Compound Name | 2-(4-hexoxycarbonyl-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium |
|---|---|
| PubChem CID | 158415577 |
| Molecular Formula | C18H20N2O4Ru |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-(4-hexoxycarbonyl-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium |
| SMILES | CCCCCCOC(=O)c1ccnc(-c2cc(C(=O)O)ccn2)c1.[Ru] |
| InChI | InChI=1S/C18H20N2O4.Ru/c1-2-3-4-5-10-24-18(23)14-7-9-20-16(12-14)15-11-13(17(21)22)6-8-19-15;/h6-9,11-12H,2-5,10H2,1H3,(H,21,22); |
| InChIKey | GZVUNKJSBZQEBM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|