About CID 158416389
CID 158416389 (PubChem CID 158416389) has the molecular formula C5H12Mg2O2
and a molecular weight of 152.76 g/mol.
Molecular Properties
| Compound Name | CID 158416389 |
| PubChem CID | 158416389 |
| Molecular Formula | C5H12Mg2O2 |
| Molecular Weight | 152.76 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | — |
| SMILES | CC(C)[O-].CC[O-].[Mg+2].[Mg] |
| InChI | InChI=1S/C3H7O.C2H5O.2Mg/c1-3(2)4;1-2-3;;/h3H,1-2H3;2H2,1H3;;/q2*-1;;+2 |
| InChIKey | FFKPRJNNCJGMNE-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.76 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 158416389 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158416389?
The IUPAC name of CID 158416389 (CID 158416389) is not available.
What is the SMILES notation for CID 158416389?
The canonical SMILES for CID 158416389 is CC(C)[O-].CC[O-].[Mg+2].[Mg].
What is the InChIKey of CID 158416389?
The InChIKey is FFKPRJNNCJGMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.C2H5O.2Mg/c1-3(2)4;1-2-3;;/h3H,1-2H3;2H2,1H3;;/q2*-1;;+2.
What are the key properties of CID 158416389?
CID 158416389 has a molecular weight of 152.76 g/mol, XLogP of -1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158416389 is sourced from PubChem (CID 158416389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).