About acridine;1,3-oxazole
acridine;1,3-oxazole (PubChem CID 158417273) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is acridine;1,3-oxazole.
Molecular Properties
| Compound Name | acridine;1,3-oxazole |
| PubChem CID | 158417273 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | acridine;1,3-oxazole |
| SMILES | c1ccc2nc3ccccc3cc2c1.c1cocn1 |
| InChI | InChI=1S/C13H9N.C3H3NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-5-3-4-1/h1-9H;1-3H |
| InChIKey | HAAZRBXWBKVWEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;1,3-oxazole?
The IUPAC name of acridine;1,3-oxazole (CID 158417273) is acridine;1,3-oxazole.
What is the SMILES notation for acridine;1,3-oxazole?
The canonical SMILES for acridine;1,3-oxazole is c1ccc2nc3ccccc3cc2c1.c1cocn1.
What is the InChIKey of acridine;1,3-oxazole?
The InChIKey is HAAZRBXWBKVWEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C3H3NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-5-3-4-1/h1-9H;1-3H.
What are the key properties of acridine;1,3-oxazole?
acridine;1,3-oxazole has a molecular weight of 248.29 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;1,3-oxazole is sourced from PubChem (CID 158417273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).