C47H38FN7O — CID 158418264
N,N-diethyl-2-[[2-(4-fluorophenyl)-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-7-yl]methyl-methylamino]acetamide;tetradeca-1,3,5,7,9,11,13-heptayne (PubChem CID 158418264) has the molecular formula C47H38FN7O and a molecular weight of 735.87 g/mol. Its IUPAC name is N,N-diethyl-2-[[2-(4-fluorophenyl)-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-7-yl]methyl-methylamino]acetamide;tetradeca-1,3,5,7,9,11,13-heptayne.
| Compound Name | N,N-diethyl-2-[[2-(4-fluorophenyl)-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-7-yl]methyl-methylamino]acetamide;tetradeca-1,3,5,7,9,11,13-heptayne |
|---|---|
| PubChem CID | 158418264 |
| Molecular Formula | C47H38FN7O |
| Molecular Weight | 735.87 g/mol |
| Exact Mass | 735.31 |
| IUPAC Name | N,N-diethyl-2-[[2-(4-fluorophenyl)-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-7-yl]methyl-methylamino]acetamide;tetradeca-1,3,5,7,9,11,13-heptayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#C.CCN(CC)C(=O)CN(C)Cc1ccn2c(-c3ccnc(N[C@@H](C)c4ccccc4)n3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C33H36FN7O.C14H2/c1-5-40(6-2)30(42)22-39(4)21-24-17-19-41-29(20-24)38-31(26-12-14-27(34)15-13-26)32(41)28-16-18-35-33(37-28)36-23(3)25-10-8-7-9-11-25;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h7-20,23H,5-6,21-22H2,1-4H3,(H,35,36,37);1-2H/t23-;/m0./s1 |
| InChIKey | HAECQAVAYHSWMZ-BQAIUKQQSA-N |
| XLogP | 6.34 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|