C23H33F8NO5 — CID 158420701
N-[2,2-bis(prop-2-enyl)pent-4-enyl]-2-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]acetamide (PubChem CID 158420701) has the molecular formula C23H33F8NO5 and a molecular weight of 555.50 g/mol. Its IUPAC name is N-[2,2-bis(prop-2-enyl)pent-4-enyl]-2-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]acetamide.
| Compound Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]-2-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]acetamide |
|---|---|
| PubChem CID | 158420701 |
| Molecular Formula | C23H33F8NO5 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]-2-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]acetamide |
| SMILES | C=CCC(CC=C)(CC=C)CN(CC(F)(F)OC(F)(F)COCC)C(=O)COCC(F)(F)OC(C)(F)F |
| InChI | InChI=1S/C23H33F8NO5/c1-6-10-20(11-7-2,12-8-3)14-32(15-21(26,27)37-23(30,31)16-34-9-4)18(33)13-35-17-22(28,29)36-19(5,24)25/h6-8H,1-3,9-17H2,4-5H3 |
| InChIKey | WTTPFETYQVFNQN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|