About 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane
2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane (PubChem CID 158420994) has the molecular formula C27H36N4
and a molecular weight of 416.61 g/mol. Its IUPAC name is 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane.
Molecular Properties
| Compound Name | 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane |
| PubChem CID | 158420994 |
| Molecular Formula | C27H36N4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane |
| SMILES | C.Cc1ccnc2ccc(C(C)(C)C)nc12.Cc1ncnc2ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/2C13H16N2.CH4/c1-9-11-7-10(13(2,3)4)5-6-12(11)15-8-14-9;1-9-7-8-14-10-5-6-11(13(2,3)4)15-12(9)10;/h2*5-8H,1-4H3;1H4 |
| InChIKey | HAMIOXIOYNPCPK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane?
The IUPAC name of 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane (CID 158420994) is 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane.
What is the SMILES notation for 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane?
The canonical SMILES for 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane is C.Cc1ccnc2ccc(C(C)(C)C)nc12.Cc1ncnc2ccc(C(C)(C)C)cc12.
What is the InChIKey of 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane?
The InChIKey is HAMIOXIOYNPCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H16N2.CH4/c1-9-11-7-10(13(2,3)4)5-6-12(11)15-8-14-9;1-9-7-8-14-10-5-6-11(13(2,3)4)15-12(9)10;/h2*5-8H,1-4H3;1H4.
What are the key properties of 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane?
2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane has a molecular weight of 416.61 g/mol, XLogP of 7.11, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-8-methyl-1,5-naphthyridine;6-tert-butyl-4-methylquinazoline;methane is sourced from PubChem (CID 158420994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).