C4Cl4F8O — CID 158421583
(2-chloro-1,1,2,2-tetrafluoroethyl) hypochlorite;1,1-dichloro-1,2,2,2-tetrafluoroethane (PubChem CID 158421583) has the molecular formula C4Cl4F8O and a molecular weight of 357.84 g/mol. Its IUPAC name is (2-chloro-1,1,2,2-tetrafluoroethyl) hypochlorite;1,1-dichloro-1,2,2,2-tetrafluoroethane.
| Compound Name | (2-chloro-1,1,2,2-tetrafluoroethyl) hypochlorite;1,1-dichloro-1,2,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 158421583 |
| Molecular Formula | C4Cl4F8O |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 355.86 |
| IUPAC Name | (2-chloro-1,1,2,2-tetrafluoroethyl) hypochlorite;1,1-dichloro-1,2,2,2-tetrafluoroethane |
| SMILES | FC(F)(Cl)C(F)(F)OCl.FC(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C2Cl2F4O.C2Cl2F4/c3-1(5,6)2(7,8)9-4;3-1(4,5)2(6,7)8 |
| InChIKey | HAOARLLIMZQKHR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|