C50H58F6N8O4 — CID 158422110
1-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]propan-2-one (PubChem CID 158422110) has the molecular formula C50H58F6N8O4 and a molecular weight of 949.05 g/mol. Its IUPAC name is 1-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]propan-2-one.
| Compound Name | 1-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 158422110 |
| Molecular Formula | C50H58F6N8O4 |
| Molecular Weight | 949.05 g/mol |
| Exact Mass | 948.45 |
| IUPAC Name | 1-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]propan-2-one |
| SMILES | O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)CC1CN(C2CCC(C3C=CCO3)CC2)C1.O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)CC1CN(C2CCC(C3C=CCO3)CC2)C1 |
| InChI | InChI=1S/2C25H29F3N4O2/c2*26-25(27,28)18-5-8-22-21(11-18)24(31-15-30-22)29-12-20(33)10-16-13-32(14-16)19-6-3-17(4-7-19)23-2-1-9-34-23/h2*1-2,5,8,11,15-17,19,23H,3-4,6-7,9-10,12-14H2,(H,29,30,31) |
| InChIKey | HAPMOYMUQFEHAR-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.05 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|