About 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one)
3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) (PubChem CID 158422148) has the molecular formula C30H58N4O3
and a molecular weight of 522.82 g/mol. Its IUPAC name is 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one).
Molecular Properties
| Compound Name | 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) |
| PubChem CID | 158422148 |
| Molecular Formula | C30H58N4O3 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.45 |
| IUPAC Name | 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) |
| SMILES | CC(C)C(=O)CN1CCCCC1.CC(C)C(=O)CN1CCCCC1.CC(C)C(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C10H20N2O.2C10H19NO/c1-9(2)10(13)8-12-6-4-11(3)5-7-12;2*1-9(2)10(12)8-11-6-4-3-5-7-11/h9H,4-8H2,1-3H3;2*9H,3-8H2,1-2H3 |
| InChIKey | HAPRDAKTIYWDQU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one)?
The IUPAC name of 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) (CID 158422148) is 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one).
What is the SMILES notation for 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one)?
The canonical SMILES for 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) is CC(C)C(=O)CN1CCCCC1.CC(C)C(=O)CN1CCCCC1.CC(C)C(=O)CN1CCN(C)CC1.
What is the InChIKey of 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one)?
The InChIKey is HAPRDAKTIYWDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.2C10H19NO/c1-9(2)10(13)8-12-6-4-11(3)5-7-12;2*1-9(2)10(12)8-11-6-4-3-5-7-11/h9H,4-8H2,1-3H3;2*9H,3-8H2,1-2H3.
What are the key properties of 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one)?
3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) has a molecular weight of 522.82 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(4-methylpiperazin-1-yl)butan-2-one;bis(3-methyl-1-piperidin-1-ylbutan-2-one) is sourced from PubChem (CID 158422148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).