About (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate
(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate (PubChem CID 15842285) has the molecular formula C7H5Cl2FN2O2
and a molecular weight of 239.03 g/mol. Its IUPAC name is (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate.
Molecular Properties
| Compound Name | (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate |
| PubChem CID | 15842285 |
| Molecular Formula | C7H5Cl2FN2O2 |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate |
| SMILES | CC(=O)Oc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C7H5Cl2FN2O2/c1-2(13)14-7-4(9)5(11)3(8)6(10)12-7/h1H3,(H2,11,12) |
| InChIKey | QVCRBKWLSCMWDM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate?
The IUPAC name of (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate (CID 15842285) is (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate.
What is the SMILES notation for (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate?
The canonical SMILES for (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate is CC(=O)Oc1nc(F)c(Cl)c(N)c1Cl.
What is the InChIKey of (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate?
The InChIKey is QVCRBKWLSCMWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2FN2O2/c1-2(13)14-7-4(9)5(11)3(8)6(10)12-7/h1H3,(H2,11,12).
What are the key properties of (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate?
(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate has a molecular weight of 239.03 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3,5-dichloro-6-fluoro-2-pyridinyl) acetate is sourced from PubChem (CID 15842285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).