About 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole
1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole (PubChem CID 158424564) has the molecular formula C28H27F3N4O2S
and a molecular weight of 540.61 g/mol. Its IUPAC name is 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole.
Molecular Properties
| Compound Name | 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole |
| PubChem CID | 158424564 |
| Molecular Formula | C28H27F3N4O2S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole |
| SMILES | Cn1cc(S(=O)(=O)c2ccccc2C(F)(F)F)c2cccc(N3CCNCC3)c21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C20H20F3N3O2S.C8H7N/c1-25-13-18(29(27,28)17-8-3-2-6-15(17)20(21,22)23)14-5-4-7-16(19(14)25)26-11-9-24-10-12-26;1-2-4-8-7(3-1)5-6-9-8/h2-8,13,24H,9-12H2,1H3;1-6,9H |
| InChIKey | HAWVYUOVXDCNBI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole?
The IUPAC name of 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole (CID 158424564) is 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole.
What is the SMILES notation for 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole?
The canonical SMILES for 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole is Cn1cc(S(=O)(=O)c2ccccc2C(F)(F)F)c2cccc(N3CCNCC3)c21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole?
The InChIKey is HAWVYUOVXDCNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N3O2S.C8H7N/c1-25-13-18(29(27,28)17-8-3-2-6-15(17)20(21,22)23)14-5-4-7-16(19(14)25)26-11-9-24-10-12-26;1-2-4-8-7(3-1)5-6-9-8/h2-8,13,24H,9-12H2,1H3;1-6,9H.
What are the key properties of 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole?
1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole has a molecular weight of 540.61 g/mol, XLogP of 5.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;1-methyl-7-piperazin-1-yl-3-[2-(trifluoromethyl)phenyl]sulfonylindole is sourced from PubChem (CID 158424564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).