About 1-amino-3-iminothiourea;bis(1,1'-biphenyl)
1-amino-3-iminothiourea;bis(1,1'-biphenyl) (PubChem CID 158427000) has the molecular formula C25H24N4S
and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-amino-3-iminothiourea;bis(1,1'-biphenyl).
Molecular Properties
| Compound Name | 1-amino-3-iminothiourea;bis(1,1'-biphenyl) |
| PubChem CID | 158427000 |
| Molecular Formula | C25H24N4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-amino-3-iminothiourea;bis(1,1'-biphenyl) |
| SMILES | [H]/N=N/C(=S)NN.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10.CH4N4S/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-4-1(6)5-3/h2*1-10H;2H,3H2,(H,5,6)/b;;4-2+ |
| InChIKey | HBEFPLFKKJQCOX-KVDNZAPZSA-N |
| XLogP | 6.47 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-iminothiourea;bis(1,1'-biphenyl) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-iminothiourea;bis(1,1'-biphenyl)?
The IUPAC name of 1-amino-3-iminothiourea;bis(1,1'-biphenyl) (CID 158427000) is 1-amino-3-iminothiourea;bis(1,1'-biphenyl).
What is the SMILES notation for 1-amino-3-iminothiourea;bis(1,1'-biphenyl)?
The canonical SMILES for 1-amino-3-iminothiourea;bis(1,1'-biphenyl) is [H]/N=N/C(=S)NN.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-amino-3-iminothiourea;bis(1,1'-biphenyl)?
The InChIKey is HBEFPLFKKJQCOX-KVDNZAPZSA-N. The full InChI is InChI=1S/2C12H10.CH4N4S/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-4-1(6)5-3/h2*1-10H;2H,3H2,(H,5,6)/b;;4-2+.
What are the key properties of 1-amino-3-iminothiourea;bis(1,1'-biphenyl)?
1-amino-3-iminothiourea;bis(1,1'-biphenyl) has a molecular weight of 412.56 g/mol, XLogP of 6.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-iminothiourea;bis(1,1'-biphenyl) is sourced from PubChem (CID 158427000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).