C21H31ClN2O3 — CID 158427524
3-[9-methoxy-3-[(3S)-oxan-3-yl]-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride (PubChem CID 158427524) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is 3-[9-methoxy-3-[(3S)-oxan-3-yl]-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride.
| Compound Name | 3-[9-methoxy-3-[(3S)-oxan-3-yl]-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 158427524 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 3-[9-methoxy-3-[(3S)-oxan-3-yl]-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride |
| SMILES | COC1(c2cccc(C(N)=O)c2)C2CCCC1CN([C@H]1CCCOC1)C2.Cl |
| InChI | InChI=1S/C21H30N2O3.ClH/c1-25-21(16-6-2-5-15(11-16)20(22)24)17-7-3-8-18(21)13-23(12-17)19-9-4-10-26-14-19;/h2,5-6,11,17-19H,3-4,7-10,12-14H2,1H3,(H2,22,24);1H/t17?,18?,19-,21?;/m0./s1 |
| InChIKey | HLICJAAGWPROSV-NKYFYJOVSA-N |
| XLogP | 2.96 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |