C37H44N2O6 — CID 158428166
methyl 6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid (PubChem CID 158428166) has the molecular formula C37H44N2O6 and a molecular weight of 612.77 g/mol. Its IUPAC name is methyl 6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid.
| Compound Name | methyl 6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 158428166 |
| Molecular Formula | C37H44N2O6 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | methyl 6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;6-(oxan-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CC(C1CCOCC1)CC3.O=C(O)c1ccc2[nH]c3c(c2c1)CC(C1CCOCC1)CC3 |
| InChI | InChI=1S/C19H23NO3.C18H21NO3/c1-22-19(21)14-3-5-18-16(11-14)15-10-13(2-4-17(15)20-18)12-6-8-23-9-7-12;20-18(21)13-2-4-17-15(10-13)14-9-12(1-3-16(14)19-17)11-5-7-22-8-6-11/h3,5,11-13,20H,2,4,6-10H2,1H3;2,4,10-12,19H,1,3,5-9H2,(H,20,21) |
| InChIKey | HBHXISCDVIRGMO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|