C41H28 — CID 158428779
10-naphthalen-1-yl-9-(4-naphthalen-2-ylphenyl)-2-(trideuteriomethyl)anthracene (PubChem CID 158428779) has the molecular formula C41H28 and a molecular weight of 523.69 g/mol. Its IUPAC name is 10-naphthalen-1-yl-9-(4-naphthalen-2-ylphenyl)-2-(trideuteriomethyl)anthracene.
| Compound Name | 10-naphthalen-1-yl-9-(4-naphthalen-2-ylphenyl)-2-(trideuteriomethyl)anthracene |
|---|---|
| PubChem CID | 158428779 |
| Molecular Formula | C41H28 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 10-naphthalen-1-yl-9-(4-naphthalen-2-ylphenyl)-2-(trideuteriomethyl)anthracene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(-c3cccc4ccccc34)c3ccccc3c(-c3ccc(-c4ccc5ccccc5c4)cc3)c2c1 |
| InChI | InChI=1S/C41H28/c1-27-17-24-38-39(25-27)40(31-21-18-29(19-22-31)33-23-20-28-9-2-3-11-32(28)26-33)36-14-6-7-15-37(36)41(38)35-16-8-12-30-10-4-5-13-34(30)35/h2-26H,1H3/i1D3 |
| InChIKey | LDFMIHDAYRLNSO-FIBGUPNXSA-N |
| XLogP | 11.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|