C25H33N3O2 — CID 158429025
adamantane;5-(2-methylpyrrolidin-1-yl)-1-phenylpyrazole-4-carboxylic acid (PubChem CID 158429025) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is adamantane;5-(2-methylpyrrolidin-1-yl)-1-phenylpyrazole-4-carboxylic acid.
| Compound Name | adamantane;5-(2-methylpyrrolidin-1-yl)-1-phenylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158429025 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | adamantane;5-(2-methylpyrrolidin-1-yl)-1-phenylpyrazole-4-carboxylic acid |
| SMILES | C1C2CC3CC1CC(C2)C3.CC1CCCN1c1c(C(=O)O)cnn1-c1ccccc1 |
| InChI | InChI=1S/C15H17N3O2.C10H16/c1-11-6-5-9-17(11)14-13(15(19)20)10-16-18(14)12-7-3-2-4-8-12;1-7-2-9-4-8(1)5-10(3-7)6-9/h2-4,7-8,10-11H,5-6,9H2,1H3,(H,19,20);7-10H,1-6H2 |
| InChIKey | HBKQGMPCRKSUMZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |