About 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene
3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene (PubChem CID 158429359) has the molecular formula C17H20N2S
and a molecular weight of 284.43 g/mol. Its IUPAC name is 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene |
| PubChem CID | 158429359 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene |
| SMILES | Cc1ccc(N)cc1C.Cc1ccc(N=C=S)cc1C |
| InChI | InChI=1S/C9H9NS.C8H11N/c1-7-3-4-9(10-6-11)5-8(7)2;1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3;3-5H,9H2,1-2H3 |
| InChIKey | HBLUACZGWYEIIJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene?
The IUPAC name of 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene (CID 158429359) is 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene.
What is the SMILES notation for 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene?
The canonical SMILES for 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene is Cc1ccc(N)cc1C.Cc1ccc(N=C=S)cc1C.
What is the InChIKey of 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene?
The InChIKey is HBLUACZGWYEIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.C8H11N/c1-7-3-4-9(10-6-11)5-8(7)2;1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3;3-5H,9H2,1-2H3.
What are the key properties of 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene?
3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene has a molecular weight of 284.43 g/mol, XLogP of 4.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylaniline;4-isothiocyanato-1,2-dimethylbenzene is sourced from PubChem (CID 158429359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).