C32H36F2N6O4 — CID 158430265
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]carbamate (PubChem CID 158430265) has the molecular formula C32H36F2N6O4 and a molecular weight of 606.67 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]carbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 158430265 |
| Molecular Formula | C32H36F2N6O4 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
| SMILES | COC(=O)N[C@@H]1[C@H](N)C[C@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(OC5CCOCC5)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C32H36F2N6O4/c1-18-11-19(12-27(35)31(18)38-32(41)42-2)24-5-8-36-16-20(24)13-29-37-17-21-3-4-28(39-40(21)29)30-25(33)14-23(15-26(30)34)44-22-6-9-43-10-7-22/h3-5,8,14-19,22,27,31H,6-7,9-13,35H2,1-2H3,(H,38,41)/t18-,19+,27+,31-/m0/s1 |
| InChIKey | HBOLPAPTXCTMKI-GQEDUCTOSA-N |
| XLogP | 4.78 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |