C14H12Cl2F4N2O3 — CID 158430373
4-chloro-2,5-difluoroaniline;1-chloro-2,5-difluoro-4-nitrobenzene;ethanol (PubChem CID 158430373) has the molecular formula C14H12Cl2F4N2O3 and a molecular weight of 403.16 g/mol. Its IUPAC name is 4-chloro-2,5-difluoroaniline;1-chloro-2,5-difluoro-4-nitrobenzene;ethanol.
| Compound Name | 4-chloro-2,5-difluoroaniline;1-chloro-2,5-difluoro-4-nitrobenzene;ethanol |
|---|---|
| PubChem CID | 158430373 |
| Molecular Formula | C14H12Cl2F4N2O3 |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 4-chloro-2,5-difluoroaniline;1-chloro-2,5-difluoro-4-nitrobenzene;ethanol |
| SMILES | CCO.Nc1cc(F)c(Cl)cc1F.O=[N+]([O-])c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C6H2ClF2NO2.C6H4ClF2N.C2H6O/c7-3-1-5(9)6(10(11)12)2-4(3)8;7-3-1-5(9)6(10)2-4(3)8;1-2-3/h1-2H;1-2H,10H2;3H,2H2,1H3 |
| InChIKey | HBOUVXRLBZAONI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|