About CID 158432013
CID 158432013 (PubChem CID 158432013) has the molecular formula C51H57BBrN2O4
and a molecular weight of 852.74 g/mol.
Molecular Properties
| Compound Name | CID 158432013 |
| PubChem CID | 158432013 |
| Molecular Formula | C51H57BBrN2O4 |
| Molecular Weight | 852.74 g/mol |
| Exact Mass | 851.36 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc3[nH]c4c(-c5cccc(-c6cc(Br)ccn6)c5)cc(-c5ccc(OCC(CC)CCCC)cc5)cc4c3c2)cc1.O[B]O |
| InChI | InChI=1S/C51H55BrN2O2.BH2O2/c1-5-9-12-35(7-3)33-55-44-21-16-37(17-22-44)39-20-25-49-47(29-39)48-31-42(38-18-23-45(24-19-38)56-34-36(8-4)13-10-6-2)30-46(51(48)54-49)40-14-11-15-41(28-40)50-32-43(52)26-27-53-50;2-1-3/h11,14-32,35-36,54H,5-10,12-13,33-34H2,1-4H3;2-3H |
| InChIKey | XROXYVPZPAPZII-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 852.74 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158432013 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158432013?
The IUPAC name of CID 158432013 (CID 158432013) is not available.
What is the SMILES notation for CID 158432013?
The canonical SMILES for CID 158432013 is CCCCC(CC)COc1ccc(-c2ccc3[nH]c4c(-c5cccc(-c6cc(Br)ccn6)c5)cc(-c5ccc(OCC(CC)CCCC)cc5)cc4c3c2)cc1.O[B]O.
What is the InChIKey of CID 158432013?
The InChIKey is XROXYVPZPAPZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H55BrN2O2.BH2O2/c1-5-9-12-35(7-3)33-55-44-21-16-37(17-22-44)39-20-25-49-47(29-39)48-31-42(38-18-23-45(24-19-38)56-34-36(8-4)13-10-6-2)30-46(51(48)54-49)40-14-11-15-41(28-40)50-32-43(52)26-27-53-50;2-1-3/h11,14-32,35-36,54H,5-10,12-13,33-34H2,1-4H3;2-3H.
What are the key properties of CID 158432013?
CID 158432013 has a molecular weight of 852.74 g/mol, XLogP of 13.84, 18 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158432013 is sourced from PubChem (CID 158432013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).