C26H41F3N6O8S2 — CID 158432904
3-[2-[5-[2-[(4-azido-2,3,6-trifluoro-5-methylphenyl)sulfonylamino]ethylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 158432904) has the molecular formula C26H41F3N6O8S2 and a molecular weight of 686.78 g/mol. Its IUPAC name is 3-[2-[5-[2-[(4-azido-2,3,6-trifluoro-5-methylphenyl)sulfonylamino]ethylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[2-[5-[2-[(4-azido-2,3,6-trifluoro-5-methylphenyl)sulfonylamino]ethylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 158432904 |
| Molecular Formula | C26H41F3N6O8S2 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | 3-[2-[5-[2-[(4-azido-2,3,6-trifluoro-5-methylphenyl)sulfonylamino]ethylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCNS(=O)(=O)c1c(F)c(C)c(N=[N+]=[N-])c(F)c1F)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C26H41F3N6O8S2/c1-8-26(5,24(37)43-14-13-35(6,7)12-9-15-44(38,39)40)16-25(3,4)23(36)31-10-11-32-45(41,42)22-18(27)17(2)21(33-34-30)19(28)20(22)29/h32H,8-16H2,1-7H3,(H-,31,36,38,39,40) |
| InChIKey | WLBYPPNQILDGAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 207.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|