C19H16F3N3O2S — CID 158436374
1-[(4S)-4-methyl-3-(2-methyl-1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone (PubChem CID 158436374) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-[(4S)-4-methyl-3-(2-methyl-1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[(4S)-4-methyl-3-(2-methyl-1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 158436374 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[(4S)-4-methyl-3-(2-methyl-1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone |
| SMILES | Cc1nc(-c2onc3c2[C@H](C)N(C(=O)Cc2cc(F)c(F)c(F)c2)CC3)cs1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-9-17-14(24-27-19(17)15-8-28-10(2)23-15)3-4-25(9)16(26)7-11-5-12(20)18(22)13(21)6-11/h5-6,8-9H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | HCGUQVIYBILOKS-VIFPVBQESA-N |
| XLogP | 4.21 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|