C15H26O4 — CID 158437119
methane;(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one (PubChem CID 158437119) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is methane;(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one.
| Compound Name | methane;(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 158437119 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | methane;(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one |
| SMILES | C.CCC/C=C\CCC[C@]1(O)C(=O)C=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22O4.CH4/c1-2-3-4-5-6-7-10-14(18)12(16)9-8-11(15)13(14)17;/h4-5,8-9,11,13,15,17-18H,2-3,6-7,10H2,1H3;1H4/b5-4-;/t11-,13+,14-;/m0./s1 |
| InChIKey | HCJCXHJXPLWMQR-UDNVXLRGSA-N |
| XLogP | 1.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|