C30H44O5 — CID 158437257
(3S,4S,6aR,6aS,6bR,8aS,11R,12aR,14aR)-3-hydroxy-3,4-dimethoxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione (PubChem CID 158437257) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (3S,4S,6aR,6aS,6bR,8aS,11R,12aR,14aR)-3-hydroxy-3,4-dimethoxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione.
| Compound Name | (3S,4S,6aR,6aS,6bR,8aS,11R,12aR,14aR)-3-hydroxy-3,4-dimethoxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione |
|---|---|
| PubChem CID | 158437257 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (3S,4S,6aR,6aS,6bR,8aS,11R,12aR,14aR)-3-hydroxy-3,4-dimethoxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione |
| SMILES | CO[C@@]1(C)C2=CC[C@H]3[C@@](C)(CC[C@@]4(C)[C@@H]5C[C@@H](C)C(=O)C[C@]5(C)CC[C@]34C)C2=CC(=O)[C@@]1(O)OC |
| InChI | InChI=1S/C30H44O5/c1-18-15-23-25(2,17-21(18)31)11-13-27(4)22-10-9-19-20(26(22,3)12-14-28(23,27)5)16-24(32)30(33,35-8)29(19,6)34-7/h9,16,18,22-23,33H,10-15,17H2,1-8H3/t18-,22+,23-,25+,26+,27-,28+,29+,30-/m1/s1 |
| InChIKey | HCJOZODINHGOCH-AUKIENDLSA-N |
| XLogP | 5.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|