About 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene
1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene (PubChem CID 158437299) has the molecular formula C24H31Cl
and a molecular weight of 354.97 g/mol. Its IUPAC name is 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene |
| PubChem CID | 158437299 |
| Molecular Formula | C24H31Cl |
| Molecular Weight | 354.97 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene |
| SMILES | CC(C)(C)/C=C/c1cccc(Cl)c1.CC(C)(C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H15Cl.C12H16/c1-12(2,3)8-7-10-5-4-6-11(13)9-10;1-12(2,3)10-9-11-7-5-4-6-8-11/h4-9H,1-3H3;4-10H,1-3H3/b8-7+;10-9+ |
| InChIKey | HCJSJXYMWMCDKJ-HYVDGJKMSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.97 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene?
The IUPAC name of 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene (CID 158437299) is 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene.
What is the SMILES notation for 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene?
The canonical SMILES for 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene is CC(C)(C)/C=C/c1cccc(Cl)c1.CC(C)(C)/C=C/c1ccccc1.
What is the InChIKey of 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene?
The InChIKey is HCJSJXYMWMCDKJ-HYVDGJKMSA-N. The full InChI is InChI=1S/C12H15Cl.C12H16/c1-12(2,3)8-7-10-5-4-6-11(13)9-10;1-12(2,3)10-9-11-7-5-4-6-8-11/h4-9H,1-3H3;4-10H,1-3H3/b8-7+;10-9+.
What are the key properties of 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene?
1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene has a molecular weight of 354.97 g/mol, XLogP of 8.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene;[(E)-3,3-dimethylbut-1-enyl]benzene is sourced from PubChem (CID 158437299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).