C17H26HfO3 — CID 158437832
5-(cyclopenta-2,4-dien-1-ylmethyl)cyclopenta-1,3-diene;ethanolate;hafnium(4+) (PubChem CID 158437832) has the molecular formula C17H26HfO3 and a molecular weight of 456.88 g/mol. Its IUPAC name is 5-(cyclopenta-2,4-dien-1-ylmethyl)cyclopenta-1,3-diene;ethanolate;hafnium(4+).
| Compound Name | 5-(cyclopenta-2,4-dien-1-ylmethyl)cyclopenta-1,3-diene;ethanolate;hafnium(4+) |
|---|---|
| PubChem CID | 158437832 |
| Molecular Formula | C17H26HfO3 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-(cyclopenta-2,4-dien-1-ylmethyl)cyclopenta-1,3-diene;ethanolate;hafnium(4+) |
| SMILES | C1=CC([CH-]C2C=CC=C2)C=C1.CC[O-].CC[O-].CC[O-].[Hf+4] |
| InChI | InChI=1S/C11H11.3C2H5O.Hf/c1-2-6-10(5-1)9-11-7-3-4-8-11;3*1-2-3;/h1-11H;3*2H2,1H3;/q4*-1;+4 |
| InChIKey | HCLJODJNKUMFJX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|