C30H40O6S — CID 158439458
cis-(3R,4S)-3-hydroxy-4-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]cyclopentan-1-one;phenyl 4-propylsulfanylbutanoate (PubChem CID 158439458) has the molecular formula C30H40O6S and a molecular weight of 528.71 g/mol. Its IUPAC name is cis-(3R,4S)-3-hydroxy-4-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]cyclopentan-1-one;phenyl 4-propylsulfanylbutanoate.
| Compound Name | cis-(3R,4S)-3-hydroxy-4-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]cyclopentan-1-one;phenyl 4-propylsulfanylbutanoate |
|---|---|
| PubChem CID | 158439458 |
| Molecular Formula | C30H40O6S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | cis-(3R,4S)-3-hydroxy-4-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]cyclopentan-1-one;phenyl 4-propylsulfanylbutanoate |
| SMILES | CCCSCCCC(=O)Oc1ccccc1.COCc1cccc(C[C@H](O)/C=C/[C@@H]2CC(=O)C[C@H]2O)c1 |
| InChI | InChI=1S/C17H22O4.C13H18O2S/c1-21-11-13-4-2-3-12(7-13)8-15(18)6-5-14-9-16(19)10-17(14)20;1-2-10-16-11-6-9-13(14)15-12-7-4-3-5-8-12/h2-7,14-15,17-18,20H,8-11H2,1H3;3-5,7-8H,2,6,9-11H2,1H3/b6-5+;/t14-,15-,17-;/m1./s1 |
| InChIKey | HCQBPMVWCSYQKZ-RJWJRHJPSA-N |
| XLogP | 5.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|