C28H29FN2O8 — CID 158439984
(2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 158439984) has the molecular formula C28H29FN2O8 and a molecular weight of 540.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 158439984 |
| Molecular Formula | C28H29FN2O8 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)c1c(CCC(=O)OC2O[C@@H](C(=O)O)[C@H](O)[C@@H](O)[C@@H]2O)c2cc3c(cc2n1-c1ccc(F)cc1)C=NC3 |
| InChI | InChI=1S/C28H29FN2O8/c1-13(2)22-18(7-8-21(32)38-28-25(35)23(33)24(34)26(39-28)27(36)37)19-9-14-11-30-12-15(14)10-20(19)31(22)17-5-3-16(29)4-6-17/h3-6,9-10,12-13,23-26,28,33-35H,7-8,11H2,1-2H3,(H,36,37)/t23-,24-,25+,26-,28?/m1/s1 |
| InChIKey | RYMCSNGROBSSTA-VBGSWAKPSA-N |
| XLogP | 2.19 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |