C31H33FN2O8 — CID 158439985
prop-2-enyl (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 158439985) has the molecular formula C31H33FN2O8 and a molecular weight of 580.61 g/mol. Its IUPAC name is prop-2-enyl (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 158439985 |
| Molecular Formula | C31H33FN2O8 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | prop-2-enyl (2R,3R,4R,5S)-6-[3-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1OC(OC(=O)CCc2c(C(C)C)n(-c3ccc(F)cc3)c3cc4c(cc23)CN=C4)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H33FN2O8/c1-4-11-40-30(39)29-27(37)26(36)28(38)31(42-29)41-24(35)10-9-21-22-12-17-14-33-15-18(17)13-23(22)34(25(21)16(2)3)20-7-5-19(32)6-8-20/h4-8,12-13,15-16,26-29,31,36-38H,1,9-11,14H2,2-3H3/t26-,27-,28+,29-,31?/m1/s1 |
| InChIKey | XNCHXXKXXREJTG-KSHFZJHMSA-N |
| XLogP | 2.84 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|