C14H9F2NO3 — CID 158441599
(3E)-3-[(E)-3-(2,6-difluorophenyl)prop-2-enylidene]piperidine-2,4,6-trione (PubChem CID 158441599) has the molecular formula C14H9F2NO3 and a molecular weight of 277.23 g/mol. Its IUPAC name is (3E)-3-[(E)-3-(2,6-difluorophenyl)prop-2-enylidene]piperidine-2,4,6-trione.
| Compound Name | (3E)-3-[(E)-3-(2,6-difluorophenyl)prop-2-enylidene]piperidine-2,4,6-trione |
|---|---|
| PubChem CID | 158441599 |
| Molecular Formula | C14H9F2NO3 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (3E)-3-[(E)-3-(2,6-difluorophenyl)prop-2-enylidene]piperidine-2,4,6-trione |
| SMILES | O=C1CC(=O)/C(=C\C=C\c2c(F)cccc2F)C(=O)N1 |
| InChI | InChI=1S/C14H9F2NO3/c15-10-5-2-6-11(16)8(10)3-1-4-9-12(18)7-13(19)17-14(9)20/h1-6H,7H2,(H,17,19,20)/b3-1+,9-4+ |
| InChIKey | MHLBQWDQNWRXJU-PTESOZBDSA-N |
| XLogP | 1.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|