C18H19F3N4 — CID 158442438
methane;(12R)-4-methyl-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine (PubChem CID 158442438) has the molecular formula C18H19F3N4 and a molecular weight of 348.37 g/mol. Its IUPAC name is methane;(12R)-4-methyl-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine.
| Compound Name | methane;(12R)-4-methyl-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
|---|---|
| PubChem CID | 158442438 |
| Molecular Formula | C18H19F3N4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methane;(12R)-4-methyl-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
| SMILES | C.Cc1cc2c(cn1)nc1n2C[C@H](N)C(c2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C17H15F3N4.CH4/c1-8-2-16-15(6-22-8)23-17-4-10(14(21)7-24(16)17)9-3-12(19)13(20)5-11(9)18;/h2-3,5-6,10,14H,4,7,21H2,1H3;1H4/t10?,14-;/m0./s1 |
| InChIKey | HCZFNSVNGIZZPB-LSWXMUKNSA-N |
| XLogP | 3.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|