C19H34O3 — CID 158442919
(2S,6S,7R)-2-[(2S,3S,5R,6R)-6-ethyl-3-hydroxy-5-methyloxan-2-yl]-6,7-dimethylnon-8-en-4-one (PubChem CID 158442919) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2S,6S,7R)-2-[(2S,3S,5R,6R)-6-ethyl-3-hydroxy-5-methyloxan-2-yl]-6,7-dimethylnon-8-en-4-one.
| Compound Name | (2S,6S,7R)-2-[(2S,3S,5R,6R)-6-ethyl-3-hydroxy-5-methyloxan-2-yl]-6,7-dimethylnon-8-en-4-one |
|---|---|
| PubChem CID | 158442919 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2S,6S,7R)-2-[(2S,3S,5R,6R)-6-ethyl-3-hydroxy-5-methyloxan-2-yl]-6,7-dimethylnon-8-en-4-one |
| SMILES | C=C[C@@H](C)[C@@H](C)CC(=O)C[C@H](C)[C@@H]1O[C@H](CC)[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C19H34O3/c1-7-12(3)13(4)9-16(20)10-15(6)19-17(21)11-14(5)18(8-2)22-19/h7,12-15,17-19,21H,1,8-11H2,2-6H3/t12-,13+,14-,15+,17+,18-,19+/m1/s1 |
| InChIKey | HDAMUWPUPMVNMW-KNABJZSUSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|