C19H12BrClFN3O2S — CID 158445107
6-bromo-3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]imidazo[1,2-a]pyridine (PubChem CID 158445107) has the molecular formula C19H12BrClFN3O2S and a molecular weight of 480.75 g/mol. Its IUPAC name is 6-bromo-3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-bromo-3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 158445107 |
| Molecular Formula | C19H12BrClFN3O2S |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | 6-bromo-3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]imidazo[1,2-a]pyridine |
| SMILES | O=S(=O)(Cc1cc(-c2cnc3ccc(Br)cn23)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H12BrClFN3O2S/c20-14-1-6-18-23-9-17(25(18)10-14)12-7-13(19(21)24-8-12)11-28(26,27)16-4-2-15(22)3-5-16/h1-10H,11H2 |
| InChIKey | KJHYOJYCNIHQGP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|