C24H16ClFN4O2S — CID 158445108
3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]-6-pyridin-4-ylimidazo[1,2-a]pyridine (PubChem CID 158445108) has the molecular formula C24H16ClFN4O2S and a molecular weight of 478.94 g/mol. Its IUPAC name is 3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]-6-pyridin-4-ylimidazo[1,2-a]pyridine.
| Compound Name | 3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]-6-pyridin-4-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 158445108 |
| Molecular Formula | C24H16ClFN4O2S |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 3-[6-chloro-5-[(4-fluorophenyl)sulfonylmethyl]-3-pyridinyl]-6-pyridin-4-ylimidazo[1,2-a]pyridine |
| SMILES | O=S(=O)(Cc1cc(-c2cnc3ccc(-c4ccncc4)cn23)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H16ClFN4O2S/c25-24-19(15-33(31,32)21-4-2-20(26)3-5-21)11-18(12-29-24)22-13-28-23-6-1-17(14-30(22)23)16-7-9-27-10-8-16/h1-14H,15H2 |
| InChIKey | XCERLHVBGUOKAT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|